About (2R,6R)-2,6-dimethyl-N-[[(2R)-oxolan-2-yl]methyl]morpholine-4-carbothioamide
(2R,6R)-2,6-dimethyl-N-[[(2R)-oxolan-2-yl]methyl]morpholine-4-carbothioamide (PubChem CID 970234) has the molecular formula C12H22N2O2S
and a molecular weight of 258.39 g/mol. Its IUPAC name is (2R,6R)-2,6-dimethyl-N-[[(2R)-oxolan-2-yl]methyl]morpholine-4-carbothioamide.
Molecular Properties
| Compound Name | (2R,6R)-2,6-dimethyl-N-[[(2R)-oxolan-2-yl]methyl]morpholine-4-carbothioamide |
| PubChem CID | 970234 |
| Molecular Formula | C12H22N2O2S |
| Molecular Weight | 258.39 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | (2R,6R)-2,6-dimethyl-N-[[(2R)-oxolan-2-yl]methyl]morpholine-4-carbothioamide |
| SMILES | C[C@@H]1CN(C(=S)NC[C@H]2CCCO2)C[C@@H](C)O1 |
| InChI | InChI=1S/C12H22N2O2S/c1-9-7-14(8-10(2)16-9)12(17)13-6-11-4-3-5-15-11/h9-11H,3-8H2,1-2H3,(H,13,17)/t9-,10-,11-/m1/s1 |
| InChIKey | XFAFRMXCZYHJRZ-GMTAPVOTSA-N |
| XLogP | 1.15 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.39 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (2R,6R)-2,6-dimethyl-N-[[(2R)-oxolan-2-yl]methyl]morpholine-4-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,6R)-2,6-dimethyl-N-[[(2R)-oxolan-2-yl]methyl]morpholine-4-carbothioamide?
The IUPAC name of (2R,6R)-2,6-dimethyl-N-[[(2R)-oxolan-2-yl]methyl]morpholine-4-carbothioamide (CID 970234) is (2R,6R)-2,6-dimethyl-N-[[(2R)-oxolan-2-yl]methyl]morpholine-4-carbothioamide.
What is the SMILES notation for (2R,6R)-2,6-dimethyl-N-[[(2R)-oxolan-2-yl]methyl]morpholine-4-carbothioamide?
The canonical SMILES for (2R,6R)-2,6-dimethyl-N-[[(2R)-oxolan-2-yl]methyl]morpholine-4-carbothioamide is C[C@@H]1CN(C(=S)NC[C@H]2CCCO2)C[C@@H](C)O1.
What is the InChIKey of (2R,6R)-2,6-dimethyl-N-[[(2R)-oxolan-2-yl]methyl]morpholine-4-carbothioamide?
The InChIKey is XFAFRMXCZYHJRZ-GMTAPVOTSA-N. The full InChI is InChI=1S/C12H22N2O2S/c1-9-7-14(8-10(2)16-9)12(17)13-6-11-4-3-5-15-11/h9-11H,3-8H2,1-2H3,(H,13,17)/t9-,10-,11-/m1/s1.
What are the key properties of (2R,6R)-2,6-dimethyl-N-[[(2R)-oxolan-2-yl]methyl]morpholine-4-carbothioamide?
(2R,6R)-2,6-dimethyl-N-[[(2R)-oxolan-2-yl]methyl]morpholine-4-carbothioamide has a molecular weight of 258.39 g/mol, XLogP of 1.15, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,6R)-2,6-dimethyl-N-[[(2R)-oxolan-2-yl]methyl]morpholine-4-carbothioamide is sourced from PubChem (CID 970234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).