C21H24FN3O4 — CID 97023871
N-[(1S,2S)-5-fluoro-2-methyl-1,2,3,4-tetrahydronaphthalen-1-yl]-N'-[2-(2-methoxyethoxy)-3-pyridinyl]oxamide (PubChem CID 97023871) has the molecular formula C21H24FN3O4 and a molecular weight of 401.44 g/mol. Its IUPAC name is N-[(1S,2S)-5-fluoro-2-methyl-1,2,3,4-tetrahydronaphthalen-1-yl]-N'-[2-(2-methoxyethoxy)-3-pyridinyl]oxamide.
| Compound Name | N-[(1S,2S)-5-fluoro-2-methyl-1,2,3,4-tetrahydronaphthalen-1-yl]-N'-[2-(2-methoxyethoxy)-3-pyridinyl]oxamide |
|---|---|
| PubChem CID | 97023871 |
| Molecular Formula | C21H24FN3O4 |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | N-[(1S,2S)-5-fluoro-2-methyl-1,2,3,4-tetrahydronaphthalen-1-yl]-N'-[2-(2-methoxyethoxy)-3-pyridinyl]oxamide |
| SMILES | COCCOc1ncccc1NC(=O)C(=O)N[C@@H]1c2cccc(F)c2CC[C@@H]1C |
| InChI | InChI=1S/C21H24FN3O4/c1-13-8-9-14-15(5-3-6-16(14)22)18(13)25-20(27)19(26)24-17-7-4-10-23-21(17)29-12-11-28-2/h3-7,10,13,18H,8-9,11-12H2,1-2H3,(H,24,26)(H,25,27)/t13-,18-/m0/s1 |
| InChIKey | ZVUAVZUZZRJABB-UGSOOPFHSA-N |
| XLogP | 2.62 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|