About [(2R)-1-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-1-oxopropan-2-yl] 4-(dimethylamino)-3-fluorobenzoate
[(2R)-1-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-1-oxopropan-2-yl] 4-(dimethylamino)-3-fluorobenzoate (PubChem CID 97024014) has the molecular formula C18H25FN2O4
and a molecular weight of 352.41 g/mol. Its IUPAC name is [(2R)-1-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-1-oxopropan-2-yl] 4-(dimethylamino)-3-fluorobenzoate.
Molecular Properties
| Compound Name | [(2R)-1-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-1-oxopropan-2-yl] 4-(dimethylamino)-3-fluorobenzoate |
| PubChem CID | 97024014 |
| Molecular Formula | C18H25FN2O4 |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | [(2R)-1-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-1-oxopropan-2-yl] 4-(dimethylamino)-3-fluorobenzoate |
| SMILES | C[C@@H]1CN(C(=O)[C@@H](C)OC(=O)c2ccc(N(C)C)c(F)c2)C[C@@H](C)O1 |
| InChI | InChI=1S/C18H25FN2O4/c1-11-9-21(10-12(2)24-11)17(22)13(3)25-18(23)14-6-7-16(20(4)5)15(19)8-14/h6-8,11-13H,9-10H2,1-5H3/t11-,12-,13-/m1/s1 |
| InChIKey | YDYPYIMOWSUMNZ-JHJVBQTASA-N |
| XLogP | 2.07 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(2R)-1-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-1-oxopropan-2-yl] 4-(dimethylamino)-3-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-1-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-1-oxopropan-2-yl] 4-(dimethylamino)-3-fluorobenzoate?
The IUPAC name of [(2R)-1-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-1-oxopropan-2-yl] 4-(dimethylamino)-3-fluorobenzoate (CID 97024014) is [(2R)-1-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-1-oxopropan-2-yl] 4-(dimethylamino)-3-fluorobenzoate.
What is the SMILES notation for [(2R)-1-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-1-oxopropan-2-yl] 4-(dimethylamino)-3-fluorobenzoate?
The canonical SMILES for [(2R)-1-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-1-oxopropan-2-yl] 4-(dimethylamino)-3-fluorobenzoate is C[C@@H]1CN(C(=O)[C@@H](C)OC(=O)c2ccc(N(C)C)c(F)c2)C[C@@H](C)O1.
What is the InChIKey of [(2R)-1-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-1-oxopropan-2-yl] 4-(dimethylamino)-3-fluorobenzoate?
The InChIKey is YDYPYIMOWSUMNZ-JHJVBQTASA-N. The full InChI is InChI=1S/C18H25FN2O4/c1-11-9-21(10-12(2)24-11)17(22)13(3)25-18(23)14-6-7-16(20(4)5)15(19)8-14/h6-8,11-13H,9-10H2,1-5H3/t11-,12-,13-/m1/s1.
What are the key properties of [(2R)-1-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-1-oxopropan-2-yl] 4-(dimethylamino)-3-fluorobenzoate?
[(2R)-1-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-1-oxopropan-2-yl] 4-(dimethylamino)-3-fluorobenzoate has a molecular weight of 352.41 g/mol, XLogP of 2.07, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-1-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-1-oxopropan-2-yl] 4-(dimethylamino)-3-fluorobenzoate is sourced from PubChem (CID 97024014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).