C25H33N3O4 — CID 97024105
(2S)-N-[3-[(2R,6R)-2,6-dimethylmorpholin-4-yl]propyl]-1-(1-hydroxynaphthalene-2-carbonyl)pyrrolidine-2-carboxamide (PubChem CID 97024105) has the molecular formula C25H33N3O4 and a molecular weight of 439.56 g/mol. Its IUPAC name is (2S)-N-[3-[(2R,6R)-2,6-dimethylmorpholin-4-yl]propyl]-1-(1-hydroxynaphthalene-2-carbonyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[3-[(2R,6R)-2,6-dimethylmorpholin-4-yl]propyl]-1-(1-hydroxynaphthalene-2-carbonyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 97024105 |
| Molecular Formula | C25H33N3O4 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | (2S)-N-[3-[(2R,6R)-2,6-dimethylmorpholin-4-yl]propyl]-1-(1-hydroxynaphthalene-2-carbonyl)pyrrolidine-2-carboxamide |
| SMILES | C[C@@H]1CN(CCCNC(=O)[C@@H]2CCCN2C(=O)c2ccc3ccccc3c2O)C[C@@H](C)O1 |
| InChI | InChI=1S/C25H33N3O4/c1-17-15-27(16-18(2)32-17)13-6-12-26-24(30)22-9-5-14-28(22)25(31)21-11-10-19-7-3-4-8-20(19)23(21)29/h3-4,7-8,10-11,17-18,22,29H,5-6,9,12-16H2,1-2H3,(H,26,30)/t17-,18-,22+/m1/s1 |
| InChIKey | XIPZRANJHIAQPA-HMFYCAOWSA-N |
| XLogP | 2.77 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|