About 1-[4-[(3R,4R)-1-(1H-imidazol-2-ylmethyl)-4-methylpyrrolidin-3-yl]piperazin-1-yl]ethanone
1-[4-[(3R,4R)-1-(1H-imidazol-2-ylmethyl)-4-methylpyrrolidin-3-yl]piperazin-1-yl]ethanone (PubChem CID 97024455) has the molecular formula C15H25N5O
and a molecular weight of 291.40 g/mol. Its IUPAC name is 1-[4-[(3R,4R)-1-(1H-imidazol-2-ylmethyl)-4-methylpyrrolidin-3-yl]piperazin-1-yl]ethanone.
Molecular Properties
| Compound Name | 1-[4-[(3R,4R)-1-(1H-imidazol-2-ylmethyl)-4-methylpyrrolidin-3-yl]piperazin-1-yl]ethanone |
| PubChem CID | 97024455 |
| Molecular Formula | C15H25N5O |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.21 |
| IUPAC Name | 1-[4-[(3R,4R)-1-(1H-imidazol-2-ylmethyl)-4-methylpyrrolidin-3-yl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN([C@H]2CN(Cc3ncc[nH]3)C[C@H]2C)CC1 |
| InChI | InChI=1S/C15H25N5O/c1-12-9-18(11-15-16-3-4-17-15)10-14(12)20-7-5-19(6-8-20)13(2)21/h3-4,12,14H,5-11H2,1-2H3,(H,16,17)/t12-,14+/m1/s1 |
| InChIKey | QMLLFNKYOWHQSG-OCCSQVGLSA-N |
| XLogP | 0.39 |
| TPSA | 55.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[4-[(3R,4R)-1-(1H-imidazol-2-ylmethyl)-4-methylpyrrolidin-3-yl]piperazin-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[(3R,4R)-1-(1H-imidazol-2-ylmethyl)-4-methylpyrrolidin-3-yl]piperazin-1-yl]ethanone?
The IUPAC name of 1-[4-[(3R,4R)-1-(1H-imidazol-2-ylmethyl)-4-methylpyrrolidin-3-yl]piperazin-1-yl]ethanone (CID 97024455) is 1-[4-[(3R,4R)-1-(1H-imidazol-2-ylmethyl)-4-methylpyrrolidin-3-yl]piperazin-1-yl]ethanone.
What is the SMILES notation for 1-[4-[(3R,4R)-1-(1H-imidazol-2-ylmethyl)-4-methylpyrrolidin-3-yl]piperazin-1-yl]ethanone?
The canonical SMILES for 1-[4-[(3R,4R)-1-(1H-imidazol-2-ylmethyl)-4-methylpyrrolidin-3-yl]piperazin-1-yl]ethanone is CC(=O)N1CCN([C@H]2CN(Cc3ncc[nH]3)C[C@H]2C)CC1.
What is the InChIKey of 1-[4-[(3R,4R)-1-(1H-imidazol-2-ylmethyl)-4-methylpyrrolidin-3-yl]piperazin-1-yl]ethanone?
The InChIKey is QMLLFNKYOWHQSG-OCCSQVGLSA-N. The full InChI is InChI=1S/C15H25N5O/c1-12-9-18(11-15-16-3-4-17-15)10-14(12)20-7-5-19(6-8-20)13(2)21/h3-4,12,14H,5-11H2,1-2H3,(H,16,17)/t12-,14+/m1/s1.
What are the key properties of 1-[4-[(3R,4R)-1-(1H-imidazol-2-ylmethyl)-4-methylpyrrolidin-3-yl]piperazin-1-yl]ethanone?
1-[4-[(3R,4R)-1-(1H-imidazol-2-ylmethyl)-4-methylpyrrolidin-3-yl]piperazin-1-yl]ethanone has a molecular weight of 291.40 g/mol, XLogP of 0.39, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[(3R,4R)-1-(1H-imidazol-2-ylmethyl)-4-methylpyrrolidin-3-yl]piperazin-1-yl]ethanone is sourced from PubChem (CID 97024455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).