C12H22N2O3S — CID 97024717
(2S)-4-[[(3aR,6aS)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]sulfonyl]-2-methylmorpholine (PubChem CID 97024717) has the molecular formula C12H22N2O3S and a molecular weight of 274.39 g/mol. Its IUPAC name is (2S)-4-[[(3aR,6aS)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]sulfonyl]-2-methylmorpholine.
| Compound Name | (2S)-4-[[(3aR,6aS)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]sulfonyl]-2-methylmorpholine |
|---|---|
| PubChem CID | 97024717 |
| Molecular Formula | C12H22N2O3S |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | (2S)-4-[[(3aR,6aS)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]sulfonyl]-2-methylmorpholine |
| SMILES | C[C@H]1CN(S(=O)(=O)N2C[C@H]3CCC[C@H]3C2)CCO1 |
| InChI | InChI=1S/C12H22N2O3S/c1-10-7-13(5-6-17-10)18(15,16)14-8-11-3-2-4-12(11)9-14/h10-12H,2-9H2,1H3/t10-,11-,12+/m0/s1 |
| InChIKey | DUPHJQPDTJEVQD-SDDRHHMPSA-N |
| XLogP | 0.68 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |