C12H26N2O3S — CID 97027567
1-methyl-1-[(2S,3R)-3-methylsulfonylbutan-2-yl]-3-pentylurea (PubChem CID 97027567) has the molecular formula C12H26N2O3S and a molecular weight of 278.42 g/mol. Its IUPAC name is 1-methyl-1-[(2S,3R)-3-methylsulfonylbutan-2-yl]-3-pentylurea.
| Compound Name | 1-methyl-1-[(2S,3R)-3-methylsulfonylbutan-2-yl]-3-pentylurea |
|---|---|
| PubChem CID | 97027567 |
| Molecular Formula | C12H26N2O3S |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 1-methyl-1-[(2S,3R)-3-methylsulfonylbutan-2-yl]-3-pentylurea |
| SMILES | CCCCCNC(=O)N(C)[C@@H](C)[C@@H](C)S(C)(=O)=O |
| InChI | InChI=1S/C12H26N2O3S/c1-6-7-8-9-13-12(15)14(4)10(2)11(3)18(5,16)17/h10-11H,6-9H2,1-5H3,(H,13,15)/t10-,11+/m0/s1 |
| InChIKey | GPUZFSYDQJFLAK-WDEREUQCSA-N |
| XLogP | 1.64 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|