About trans-(1R,2R)-N-butylsulfonyl-2-(2,6-difluorophenyl)-N-methylcyclopropane-1-carboxamide
trans-(1R,2R)-N-butylsulfonyl-2-(2,6-difluorophenyl)-N-methylcyclopropane-1-carboxamide (PubChem CID 97027647) has the molecular formula C15H19F2NO3S
and a molecular weight of 331.38 g/mol. Its IUPAC name is trans-(1R,2R)-N-butylsulfonyl-2-(2,6-difluorophenyl)-N-methylcyclopropane-1-carboxamide.
Molecular Properties
| Compound Name | trans-(1R,2R)-N-butylsulfonyl-2-(2,6-difluorophenyl)-N-methylcyclopropane-1-carboxamide |
| PubChem CID | 97027647 |
| Molecular Formula | C15H19F2NO3S |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | trans-(1R,2R)-N-butylsulfonyl-2-(2,6-difluorophenyl)-N-methylcyclopropane-1-carboxamide |
| SMILES | CCCCS(=O)(=O)N(C)C(=O)[C@@H]1C[C@H]1c1c(F)cccc1F |
| InChI | InChI=1S/C15H19F2NO3S/c1-3-4-8-22(20,21)18(2)15(19)11-9-10(11)14-12(16)6-5-7-13(14)17/h5-7,10-11H,3-4,8-9H2,1-2H3/t10-,11-/m1/s1 |
| InChIKey | MLWPQUILHHRNTP-GHMZBOCLSA-N |
| XLogP | 2.66 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze trans-(1R,2R)-N-butylsulfonyl-2-(2,6-difluorophenyl)-N-methylcyclopropane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1R,2R)-N-butylsulfonyl-2-(2,6-difluorophenyl)-N-methylcyclopropane-1-carboxamide?
The IUPAC name of trans-(1R,2R)-N-butylsulfonyl-2-(2,6-difluorophenyl)-N-methylcyclopropane-1-carboxamide (CID 97027647) is trans-(1R,2R)-N-butylsulfonyl-2-(2,6-difluorophenyl)-N-methylcyclopropane-1-carboxamide.
What is the SMILES notation for trans-(1R,2R)-N-butylsulfonyl-2-(2,6-difluorophenyl)-N-methylcyclopropane-1-carboxamide?
The canonical SMILES for trans-(1R,2R)-N-butylsulfonyl-2-(2,6-difluorophenyl)-N-methylcyclopropane-1-carboxamide is CCCCS(=O)(=O)N(C)C(=O)[C@@H]1C[C@H]1c1c(F)cccc1F.
What is the InChIKey of trans-(1R,2R)-N-butylsulfonyl-2-(2,6-difluorophenyl)-N-methylcyclopropane-1-carboxamide?
The InChIKey is MLWPQUILHHRNTP-GHMZBOCLSA-N. The full InChI is InChI=1S/C15H19F2NO3S/c1-3-4-8-22(20,21)18(2)15(19)11-9-10(11)14-12(16)6-5-7-13(14)17/h5-7,10-11H,3-4,8-9H2,1-2H3/t10-,11-/m1/s1.
What are the key properties of trans-(1R,2R)-N-butylsulfonyl-2-(2,6-difluorophenyl)-N-methylcyclopropane-1-carboxamide?
trans-(1R,2R)-N-butylsulfonyl-2-(2,6-difluorophenyl)-N-methylcyclopropane-1-carboxamide has a molecular weight of 331.38 g/mol, XLogP of 2.66, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1R,2R)-N-butylsulfonyl-2-(2,6-difluorophenyl)-N-methylcyclopropane-1-carboxamide is sourced from PubChem (CID 97027647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).