C13H20N2O — CID 97028200
1-ethyl-1-methyl-3-[(2S)-2-phenylpropyl]urea (PubChem CID 97028200) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is 1-ethyl-1-methyl-3-[(2S)-2-phenylpropyl]urea.
| Compound Name | 1-ethyl-1-methyl-3-[(2S)-2-phenylpropyl]urea |
|---|---|
| PubChem CID | 97028200 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 1-ethyl-1-methyl-3-[(2S)-2-phenylpropyl]urea |
| SMILES | CCN(C)C(=O)NC[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C13H20N2O/c1-4-15(3)13(16)14-10-11(2)12-8-6-5-7-9-12/h5-9,11H,4,10H2,1-3H3,(H,14,16)/t11-/m1/s1 |
| InChIKey | HIKYUUBRPSUYLS-LLVKDONJSA-N |
| XLogP | 2.45 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |