C18H26N2O — CID 97028256
1-cyclohexyl-1-ethyl-3-[(1S,2S)-2-phenylcyclopropyl]urea (PubChem CID 97028256) has the molecular formula C18H26N2O and a molecular weight of 286.42 g/mol. Its IUPAC name is 1-cyclohexyl-1-ethyl-3-[(1S,2S)-2-phenylcyclopropyl]urea.
| Compound Name | 1-cyclohexyl-1-ethyl-3-[(1S,2S)-2-phenylcyclopropyl]urea |
|---|---|
| PubChem CID | 97028256 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | 1-cyclohexyl-1-ethyl-3-[(1S,2S)-2-phenylcyclopropyl]urea |
| SMILES | CCN(C(=O)N[C@H]1C[C@H]1c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C18H26N2O/c1-2-20(15-11-7-4-8-12-15)18(21)19-17-13-16(17)14-9-5-3-6-10-14/h3,5-6,9-10,15-17H,2,4,7-8,11-13H2,1H3,(H,19,21)/t16-,17-/m0/s1 |
| InChIKey | GGSVKMCQIHUTBS-IRXDYDNUSA-N |
| XLogP | 3.91 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |