C20H28N4O — CID 97028330
(2R)-N,N-diethyl-2-phenyl-2-[[(8R)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-yl]methylamino]acetamide (PubChem CID 97028330) has the molecular formula C20H28N4O and a molecular weight of 340.47 g/mol. Its IUPAC name is (2R)-N,N-diethyl-2-phenyl-2-[[(8R)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-yl]methylamino]acetamide.
| Compound Name | (2R)-N,N-diethyl-2-phenyl-2-[[(8R)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-yl]methylamino]acetamide |
|---|---|
| PubChem CID | 97028330 |
| Molecular Formula | C20H28N4O |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.23 |
| IUPAC Name | (2R)-N,N-diethyl-2-phenyl-2-[[(8R)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-yl]methylamino]acetamide |
| SMILES | CCN(CC)C(=O)[C@H](NC[C@H]1CCCn2ccnc21)c1ccccc1 |
| InChI | InChI=1S/C20H28N4O/c1-3-23(4-2)20(25)18(16-9-6-5-7-10-16)22-15-17-11-8-13-24-14-12-21-19(17)24/h5-7,9-10,12,14,17-18,22H,3-4,8,11,13,15H2,1-2H3/t17-,18-/m1/s1 |
| InChIKey | DUKQJYVCUIHDOZ-QZTJIDSGSA-N |
| XLogP | 2.96 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |