C11H16N2O — CID 97028375
(3R,4S)-3-amino-1,6-dimethyl-3,4-dihydro-2H-quinolin-4-ol (PubChem CID 97028375) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is (3R,4S)-3-amino-1,6-dimethyl-3,4-dihydro-2H-quinolin-4-ol.
| Compound Name | (3R,4S)-3-amino-1,6-dimethyl-3,4-dihydro-2H-quinolin-4-ol |
|---|---|
| PubChem CID | 97028375 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | (3R,4S)-3-amino-1,6-dimethyl-3,4-dihydro-2H-quinolin-4-ol |
| SMILES | Cc1ccc2c(c1)[C@H](O)[C@H](N)CN2C |
| InChI | InChI=1S/C11H16N2O/c1-7-3-4-10-8(5-7)11(14)9(12)6-13(10)2/h3-5,9,11,14H,6,12H2,1-2H3/t9-,11+/m1/s1 |
| InChIKey | WZBHDROUCHBDAS-KOLCDFICSA-N |
| XLogP | 0.81 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |