C18H19F2N3O2 — CID 97028949
4-[(2R)-2-(3,4-difluorophenyl)morpholin-4-yl]-N-ethylpyridine-2-carboxamide (PubChem CID 97028949) has the molecular formula C18H19F2N3O2 and a molecular weight of 347.37 g/mol. Its IUPAC name is 4-[(2R)-2-(3,4-difluorophenyl)morpholin-4-yl]-N-ethylpyridine-2-carboxamide.
| Compound Name | 4-[(2R)-2-(3,4-difluorophenyl)morpholin-4-yl]-N-ethylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 97028949 |
| Molecular Formula | C18H19F2N3O2 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 4-[(2R)-2-(3,4-difluorophenyl)morpholin-4-yl]-N-ethylpyridine-2-carboxamide |
| SMILES | CCNC(=O)c1cc(N2CCO[C@H](c3ccc(F)c(F)c3)C2)ccn1 |
| InChI | InChI=1S/C18H19F2N3O2/c1-2-21-18(24)16-10-13(5-6-22-16)23-7-8-25-17(11-23)12-3-4-14(19)15(20)9-12/h3-6,9-10,17H,2,7-8,11H2,1H3,(H,21,24)/t17-/m0/s1 |
| InChIKey | BWIJWKUYQHOBFR-KRWDZBQOSA-N |
| XLogP | 2.69 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |