About 2-[(2S)-4-bromo-2,3-dihydro-1H-inden-2-yl]acetic acid
2-[(2S)-4-bromo-2,3-dihydro-1H-inden-2-yl]acetic acid (PubChem CID 97029289) has the molecular formula C11H11BrO2
and a molecular weight of 255.11 g/mol. Its IUPAC name is 2-[(2S)-4-bromo-2,3-dihydro-1H-inden-2-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[(2S)-4-bromo-2,3-dihydro-1H-inden-2-yl]acetic acid |
| PubChem CID | 97029289 |
| Molecular Formula | C11H11BrO2 |
| Molecular Weight | 255.11 g/mol |
| Exact Mass | 253.99 |
| IUPAC Name | 2-[(2S)-4-bromo-2,3-dihydro-1H-inden-2-yl]acetic acid |
| SMILES | O=C(O)C[C@H]1Cc2cccc(Br)c2C1 |
| InChI | InChI=1S/C11H11BrO2/c12-10-3-1-2-8-4-7(5-9(8)10)6-11(13)14/h1-3,7H,4-6H2,(H,13,14)/t7-/m0/s1 |
| InChIKey | HSYQFRSSVYDCLX-ZETCQYMHSA-N |
| XLogP | 2.64 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.11 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-[(2S)-4-bromo-2,3-dihydro-1H-inden-2-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2S)-4-bromo-2,3-dihydro-1H-inden-2-yl]acetic acid?
The IUPAC name of 2-[(2S)-4-bromo-2,3-dihydro-1H-inden-2-yl]acetic acid (CID 97029289) is 2-[(2S)-4-bromo-2,3-dihydro-1H-inden-2-yl]acetic acid.
What is the SMILES notation for 2-[(2S)-4-bromo-2,3-dihydro-1H-inden-2-yl]acetic acid?
The canonical SMILES for 2-[(2S)-4-bromo-2,3-dihydro-1H-inden-2-yl]acetic acid is O=C(O)C[C@H]1Cc2cccc(Br)c2C1.
What is the InChIKey of 2-[(2S)-4-bromo-2,3-dihydro-1H-inden-2-yl]acetic acid?
The InChIKey is HSYQFRSSVYDCLX-ZETCQYMHSA-N. The full InChI is InChI=1S/C11H11BrO2/c12-10-3-1-2-8-4-7(5-9(8)10)6-11(13)14/h1-3,7H,4-6H2,(H,13,14)/t7-/m0/s1.
What are the key properties of 2-[(2S)-4-bromo-2,3-dihydro-1H-inden-2-yl]acetic acid?
2-[(2S)-4-bromo-2,3-dihydro-1H-inden-2-yl]acetic acid has a molecular weight of 255.11 g/mol, XLogP of 2.64, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2S)-4-bromo-2,3-dihydro-1H-inden-2-yl]acetic acid is sourced from PubChem (CID 97029289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).