About N-[(3R,4S)-1-(3-ethoxypropyl)-3-methylpiperidin-4-yl]pyridin-2-amine
N-[(3R,4S)-1-(3-ethoxypropyl)-3-methylpiperidin-4-yl]pyridin-2-amine (PubChem CID 97029599) has the molecular formula C16H27N3O
and a molecular weight of 277.41 g/mol. Its IUPAC name is N-[(3R,4S)-1-(3-ethoxypropyl)-3-methylpiperidin-4-yl]pyridin-2-amine.
Molecular Properties
| Compound Name | N-[(3R,4S)-1-(3-ethoxypropyl)-3-methylpiperidin-4-yl]pyridin-2-amine |
| PubChem CID | 97029599 |
| Molecular Formula | C16H27N3O |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.22 |
| IUPAC Name | N-[(3R,4S)-1-(3-ethoxypropyl)-3-methylpiperidin-4-yl]pyridin-2-amine |
| SMILES | CCOCCCN1CC[C@H](Nc2ccccn2)[C@H](C)C1 |
| InChI | InChI=1S/C16H27N3O/c1-3-20-12-6-10-19-11-8-15(14(2)13-19)18-16-7-4-5-9-17-16/h4-5,7,9,14-15H,3,6,8,10-13H2,1-2H3,(H,17,18)/t14-,15+/m1/s1 |
| InChIKey | MZIUZDABHUDNKE-CABCVRRESA-N |
| XLogP | 2.63 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[(3R,4S)-1-(3-ethoxypropyl)-3-methylpiperidin-4-yl]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3R,4S)-1-(3-ethoxypropyl)-3-methylpiperidin-4-yl]pyridin-2-amine?
The IUPAC name of N-[(3R,4S)-1-(3-ethoxypropyl)-3-methylpiperidin-4-yl]pyridin-2-amine (CID 97029599) is N-[(3R,4S)-1-(3-ethoxypropyl)-3-methylpiperidin-4-yl]pyridin-2-amine.
What is the SMILES notation for N-[(3R,4S)-1-(3-ethoxypropyl)-3-methylpiperidin-4-yl]pyridin-2-amine?
The canonical SMILES for N-[(3R,4S)-1-(3-ethoxypropyl)-3-methylpiperidin-4-yl]pyridin-2-amine is CCOCCCN1CC[C@H](Nc2ccccn2)[C@H](C)C1.
What is the InChIKey of N-[(3R,4S)-1-(3-ethoxypropyl)-3-methylpiperidin-4-yl]pyridin-2-amine?
The InChIKey is MZIUZDABHUDNKE-CABCVRRESA-N. The full InChI is InChI=1S/C16H27N3O/c1-3-20-12-6-10-19-11-8-15(14(2)13-19)18-16-7-4-5-9-17-16/h4-5,7,9,14-15H,3,6,8,10-13H2,1-2H3,(H,17,18)/t14-,15+/m1/s1.
What are the key properties of N-[(3R,4S)-1-(3-ethoxypropyl)-3-methylpiperidin-4-yl]pyridin-2-amine?
N-[(3R,4S)-1-(3-ethoxypropyl)-3-methylpiperidin-4-yl]pyridin-2-amine has a molecular weight of 277.41 g/mol, XLogP of 2.63, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3R,4S)-1-(3-ethoxypropyl)-3-methylpiperidin-4-yl]pyridin-2-amine is sourced from PubChem (CID 97029599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).