About [3-[[4-(4-methyl-1,3-thiazol-2-yl)-1,4-diazepan-1-yl]methyl]oxetan-3-yl]methanol
[3-[[4-(4-methyl-1,3-thiazol-2-yl)-1,4-diazepan-1-yl]methyl]oxetan-3-yl]methanol (PubChem CID 97030483) has the molecular formula C14H23N3O2S
and a molecular weight of 297.42 g/mol. Its IUPAC name is [3-[[4-(4-methyl-1,3-thiazol-2-yl)-1,4-diazepan-1-yl]methyl]oxetan-3-yl]methanol.
Molecular Properties
| Compound Name | [3-[[4-(4-methyl-1,3-thiazol-2-yl)-1,4-diazepan-1-yl]methyl]oxetan-3-yl]methanol |
| PubChem CID | 97030483 |
| Molecular Formula | C14H23N3O2S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | [3-[[4-(4-methyl-1,3-thiazol-2-yl)-1,4-diazepan-1-yl]methyl]oxetan-3-yl]methanol |
| SMILES | Cc1csc(N2CCCN(CC3(CO)COC3)CC2)n1 |
| InChI | InChI=1S/C14H23N3O2S/c1-12-7-20-13(15-12)17-4-2-3-16(5-6-17)8-14(9-18)10-19-11-14/h7,18H,2-6,8-11H2,1H3 |
| InChIKey | PSBUVKKGULRPKM-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 48.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [3-[[4-(4-methyl-1,3-thiazol-2-yl)-1,4-diazepan-1-yl]methyl]oxetan-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[[4-(4-methyl-1,3-thiazol-2-yl)-1,4-diazepan-1-yl]methyl]oxetan-3-yl]methanol?
The IUPAC name of [3-[[4-(4-methyl-1,3-thiazol-2-yl)-1,4-diazepan-1-yl]methyl]oxetan-3-yl]methanol (CID 97030483) is [3-[[4-(4-methyl-1,3-thiazol-2-yl)-1,4-diazepan-1-yl]methyl]oxetan-3-yl]methanol.
What is the SMILES notation for [3-[[4-(4-methyl-1,3-thiazol-2-yl)-1,4-diazepan-1-yl]methyl]oxetan-3-yl]methanol?
The canonical SMILES for [3-[[4-(4-methyl-1,3-thiazol-2-yl)-1,4-diazepan-1-yl]methyl]oxetan-3-yl]methanol is Cc1csc(N2CCCN(CC3(CO)COC3)CC2)n1.
What is the InChIKey of [3-[[4-(4-methyl-1,3-thiazol-2-yl)-1,4-diazepan-1-yl]methyl]oxetan-3-yl]methanol?
The InChIKey is PSBUVKKGULRPKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N3O2S/c1-12-7-20-13(15-12)17-4-2-3-16(5-6-17)8-14(9-18)10-19-11-14/h7,18H,2-6,8-11H2,1H3.
What are the key properties of [3-[[4-(4-methyl-1,3-thiazol-2-yl)-1,4-diazepan-1-yl]methyl]oxetan-3-yl]methanol?
[3-[[4-(4-methyl-1,3-thiazol-2-yl)-1,4-diazepan-1-yl]methyl]oxetan-3-yl]methanol has a molecular weight of 297.42 g/mol, XLogP of 0.97, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[[4-(4-methyl-1,3-thiazol-2-yl)-1,4-diazepan-1-yl]methyl]oxetan-3-yl]methanol is sourced from PubChem (CID 97030483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).