C14H25N — CID 97030527
cis-(1S,2R)-N-[2-(cyclohexen-1-yl)ethyl]-2-methylcyclopentan-1-amine (PubChem CID 97030527) has the molecular formula C14H25N and a molecular weight of 207.36 g/mol. Its IUPAC name is cis-(1S,2R)-N-[2-(cyclohexen-1-yl)ethyl]-2-methylcyclopentan-1-amine.
| Compound Name | cis-(1S,2R)-N-[2-(cyclohexen-1-yl)ethyl]-2-methylcyclopentan-1-amine |
|---|---|
| PubChem CID | 97030527 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | cis-(1S,2R)-N-[2-(cyclohexen-1-yl)ethyl]-2-methylcyclopentan-1-amine |
| SMILES | C[C@@H]1CCC[C@@H]1NCCC1=CCCCC1 |
| InChI | InChI=1S/C14H25N/c1-12-6-5-9-14(12)15-11-10-13-7-3-2-4-8-13/h7,12,14-15H,2-6,8-11H2,1H3/t12-,14+/m1/s1 |
| InChIKey | FCSBTKUGKJNZIL-OCCSQVGLSA-N |
| XLogP | 3.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|