C6H13NOS — CID 97031539
(1R,5S)-5-methyl-1,4-thiazepane 1-oxide (PubChem CID 97031539) has the molecular formula C6H13NOS and a molecular weight of 147.24 g/mol. Its IUPAC name is (1R,5S)-5-methyl-1,4-thiazepane 1-oxide.
| Compound Name | (1R,5S)-5-methyl-1,4-thiazepane 1-oxide |
|---|---|
| PubChem CID | 97031539 |
| Molecular Formula | C6H13NOS |
| Molecular Weight | 147.24 g/mol |
| Exact Mass | 147.07 |
| IUPAC Name | (1R,5S)-5-methyl-1,4-thiazepane 1-oxide |
| SMILES | C[C@H]1CC[S@@](=O)CCN1 |
| InChI | InChI=1S/C6H13NOS/c1-6-2-4-9(8)5-3-7-6/h6-7H,2-5H2,1H3/t6-,9+/m0/s1 |
| InChIKey | QPIBDXWIHXCSIZ-IMTBSYHQSA-N |
| XLogP | 0.12 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.24 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |