C8H12ClN3 — CID 97032173
2-chloro-6-methyl-4,5,7,8-tetrahydro-1H-pyrido[4,3-d]pyrimidine (PubChem CID 97032173) has the molecular formula C8H12ClN3 and a molecular weight of 185.66 g/mol. Its IUPAC name is 2-chloro-6-methyl-4,5,7,8-tetrahydro-1H-pyrido[4,3-d]pyrimidine.
| Compound Name | 2-chloro-6-methyl-4,5,7,8-tetrahydro-1H-pyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 97032173 |
| Molecular Formula | C8H12ClN3 |
| Molecular Weight | 185.66 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | 2-chloro-6-methyl-4,5,7,8-tetrahydro-1H-pyrido[4,3-d]pyrimidine |
| SMILES | CN1CCC2=C(CN=C(Cl)N2)C1 |
| InChI | InChI=1S/C8H12ClN3/c1-12-3-2-7-6(5-12)4-10-8(9)11-7/h2-5H2,1H3,(H,10,11) |
| InChIKey | HVDXTQLKUCJGKF-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.66 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|