C13H14N2O2S — CID 970322
2-ethylsulfanyl-N-(5-methyl-1,2-oxazol-3-yl)benzamide (PubChem CID 970322) has the molecular formula C13H14N2O2S and a molecular weight of 262.33 g/mol. Its IUPAC name is 2-ethylsulfanyl-N-(5-methyl-1,2-oxazol-3-yl)benzamide.
| Compound Name | 2-ethylsulfanyl-N-(5-methyl-1,2-oxazol-3-yl)benzamide |
|---|---|
| PubChem CID | 970322 |
| Molecular Formula | C13H14N2O2S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 2-ethylsulfanyl-N-(5-methyl-1,2-oxazol-3-yl)benzamide |
| SMILES | CCSc1ccccc1C(=O)Nc1cc(C)on1 |
| InChI | InChI=1S/C13H14N2O2S/c1-3-18-11-7-5-4-6-10(11)13(16)14-12-8-9(2)17-15-12/h4-8H,3H2,1-2H3,(H,14,15,16) |
| InChIKey | KXEFVOAHPJJCAO-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |