C10H12ClN3O2 — CID 97032907
(5R)-3-(1-ethyl-5-methylpyrazol-4-yl)-4,5-dihydro-1,2-oxazole-5-carbonyl chloride (PubChem CID 97032907) has the molecular formula C10H12ClN3O2 and a molecular weight of 241.68 g/mol. Its IUPAC name is (5R)-3-(1-ethyl-5-methylpyrazol-4-yl)-4,5-dihydro-1,2-oxazole-5-carbonyl chloride.
| Compound Name | (5R)-3-(1-ethyl-5-methylpyrazol-4-yl)-4,5-dihydro-1,2-oxazole-5-carbonyl chloride |
|---|---|
| PubChem CID | 97032907 |
| Molecular Formula | C10H12ClN3O2 |
| Molecular Weight | 241.68 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | (5R)-3-(1-ethyl-5-methylpyrazol-4-yl)-4,5-dihydro-1,2-oxazole-5-carbonyl chloride |
| SMILES | CCn1ncc(C2=NO[C@@H](C(=O)Cl)C2)c1C |
| InChI | InChI=1S/C10H12ClN3O2/c1-3-14-6(2)7(5-12-14)8-4-9(10(11)15)16-13-8/h5,9H,3-4H2,1-2H3/t9-/m1/s1 |
| InChIKey | WOHOTMKEDSODPL-SECBINFHSA-N |
| XLogP | 1.47 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.68 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|