About (1aR,7aS)-5-fluoro-7-oxo-1,7a-dihydrocyclopropa[b]chromene-1a-carboxylic acid
(1aR,7aS)-5-fluoro-7-oxo-1,7a-dihydrocyclopropa[b]chromene-1a-carboxylic acid (PubChem CID 97034451) has the molecular formula C11H7FO4
and a molecular weight of 222.17 g/mol. Its IUPAC name is (1aR,7aS)-5-fluoro-7-oxo-1,7a-dihydrocyclopropa[b]chromene-1a-carboxylic acid.
Molecular Properties
| Compound Name | (1aR,7aS)-5-fluoro-7-oxo-1,7a-dihydrocyclopropa[b]chromene-1a-carboxylic acid |
| PubChem CID | 97034451 |
| Molecular Formula | C11H7FO4 |
| Molecular Weight | 222.17 g/mol |
| Exact Mass | 222.03 |
| IUPAC Name | (1aR,7aS)-5-fluoro-7-oxo-1,7a-dihydrocyclopropa[b]chromene-1a-carboxylic acid |
| SMILES | O=C1c2cc(F)ccc2O[C@]2(C(=O)O)C[C@H]12 |
| InChI | InChI=1S/C11H7FO4/c12-5-1-2-8-6(3-5)9(13)7-4-11(7,16-8)10(14)15/h1-3,7H,4H2,(H,14,15)/t7-,11-/m1/s1 |
| InChIKey | CMFJHHMSEXGISQ-RDDDGLTNSA-N |
| XLogP | 1.24 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.17 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1aR,7aS)-5-fluoro-7-oxo-1,7a-dihydrocyclopropa[b]chromene-1a-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1aR,7aS)-5-fluoro-7-oxo-1,7a-dihydrocyclopropa[b]chromene-1a-carboxylic acid?
The IUPAC name of (1aR,7aS)-5-fluoro-7-oxo-1,7a-dihydrocyclopropa[b]chromene-1a-carboxylic acid (CID 97034451) is (1aR,7aS)-5-fluoro-7-oxo-1,7a-dihydrocyclopropa[b]chromene-1a-carboxylic acid.
What is the SMILES notation for (1aR,7aS)-5-fluoro-7-oxo-1,7a-dihydrocyclopropa[b]chromene-1a-carboxylic acid?
The canonical SMILES for (1aR,7aS)-5-fluoro-7-oxo-1,7a-dihydrocyclopropa[b]chromene-1a-carboxylic acid is O=C1c2cc(F)ccc2O[C@]2(C(=O)O)C[C@H]12.
What is the InChIKey of (1aR,7aS)-5-fluoro-7-oxo-1,7a-dihydrocyclopropa[b]chromene-1a-carboxylic acid?
The InChIKey is CMFJHHMSEXGISQ-RDDDGLTNSA-N. The full InChI is InChI=1S/C11H7FO4/c12-5-1-2-8-6(3-5)9(13)7-4-11(7,16-8)10(14)15/h1-3,7H,4H2,(H,14,15)/t7-,11-/m1/s1.
What are the key properties of (1aR,7aS)-5-fluoro-7-oxo-1,7a-dihydrocyclopropa[b]chromene-1a-carboxylic acid?
(1aR,7aS)-5-fluoro-7-oxo-1,7a-dihydrocyclopropa[b]chromene-1a-carboxylic acid has a molecular weight of 222.17 g/mol, XLogP of 1.24, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1aR,7aS)-5-fluoro-7-oxo-1,7a-dihydrocyclopropa[b]chromene-1a-carboxylic acid is sourced from PubChem (CID 97034451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).