C9H19NO — CID 97035537
(1S)-1-[1-(aminomethyl)-3-methylcyclobutyl]propan-1-ol (PubChem CID 97035537) has the molecular formula C9H19NO and a molecular weight of 157.26 g/mol. Its IUPAC name is (1S)-1-[1-(aminomethyl)-3-methylcyclobutyl]propan-1-ol.
| Compound Name | (1S)-1-[1-(aminomethyl)-3-methylcyclobutyl]propan-1-ol |
|---|---|
| PubChem CID | 97035537 |
| Molecular Formula | C9H19NO |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.15 |
| IUPAC Name | (1S)-1-[1-(aminomethyl)-3-methylcyclobutyl]propan-1-ol |
| SMILES | CC[C@H](O)C1(CN)CC(C)C1 |
| InChI | InChI=1S/C9H19NO/c1-3-8(11)9(6-10)4-7(2)5-9/h7-8,11H,3-6,10H2,1-2H3/t7?,8-,9?/m0/s1 |
| InChIKey | SOZGMHJZNXLNMW-MGURRDGZSA-N |
| XLogP | 1.13 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |