About [4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl benzoate
[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl benzoate (PubChem CID 97035708) has the molecular formula C12H8F3NO2S
and a molecular weight of 287.26 g/mol. Its IUPAC name is [4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl benzoate.
Molecular Properties
| Compound Name | [4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl benzoate |
| PubChem CID | 97035708 |
| Molecular Formula | C12H8F3NO2S |
| Molecular Weight | 287.26 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | [4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl benzoate |
| SMILES | O=C(OCc1nc(C(F)(F)F)cs1)c1ccccc1 |
| InChI | InChI=1S/C12H8F3NO2S/c13-12(14,15)9-7-19-10(16-9)6-18-11(17)8-4-2-1-3-5-8/h1-5,7H,6H2 |
| InChIKey | MIGOPHROQRPFSQ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.26 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl benzoate?
The IUPAC name of [4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl benzoate (CID 97035708) is [4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl benzoate.
What is the SMILES notation for [4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl benzoate?
The canonical SMILES for [4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl benzoate is O=C(OCc1nc(C(F)(F)F)cs1)c1ccccc1.
What is the InChIKey of [4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl benzoate?
The InChIKey is MIGOPHROQRPFSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8F3NO2S/c13-12(14,15)9-7-19-10(16-9)6-18-11(17)8-4-2-1-3-5-8/h1-5,7H,6H2.
What are the key properties of [4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl benzoate?
[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl benzoate has a molecular weight of 287.26 g/mol, XLogP of 3.52, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl benzoate is sourced from PubChem (CID 97035708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).