C20H20N2O2 — CID 97036198
3-[3,5-dimethyl-1-(4-phenylphenyl)pyrazol-4-yl]propanoic acid (PubChem CID 97036198) has the molecular formula C20H20N2O2 and a molecular weight of 320.39 g/mol. Its IUPAC name is 3-[3,5-dimethyl-1-(4-phenylphenyl)pyrazol-4-yl]propanoic acid.
| Compound Name | 3-[3,5-dimethyl-1-(4-phenylphenyl)pyrazol-4-yl]propanoic acid |
|---|---|
| PubChem CID | 97036198 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 3-[3,5-dimethyl-1-(4-phenylphenyl)pyrazol-4-yl]propanoic acid |
| SMILES | Cc1nn(-c2ccc(-c3ccccc3)cc2)c(C)c1CCC(=O)O |
| InChI | InChI=1S/C20H20N2O2/c1-14-19(12-13-20(23)24)15(2)22(21-14)18-10-8-17(9-11-18)16-6-4-3-5-7-16/h3-11H,12-13H2,1-2H3,(H,23,24) |
| InChIKey | AONXINXEDGKDHU-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |