C26H29NO3 — CID 97037046
N-[(1R)-1-(2-ethyl-4,5-dimethoxyphenyl)-2-phenylethyl]-2-phenylacetamide (PubChem CID 97037046) has the molecular formula C26H29NO3 and a molecular weight of 403.52 g/mol. Its IUPAC name is N-[(1R)-1-(2-ethyl-4,5-dimethoxyphenyl)-2-phenylethyl]-2-phenylacetamide.
| Compound Name | N-[(1R)-1-(2-ethyl-4,5-dimethoxyphenyl)-2-phenylethyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 97037046 |
| Molecular Formula | C26H29NO3 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | N-[(1R)-1-(2-ethyl-4,5-dimethoxyphenyl)-2-phenylethyl]-2-phenylacetamide |
| SMILES | CCc1cc(OC)c(OC)cc1[C@@H](Cc1ccccc1)NC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C26H29NO3/c1-4-21-17-24(29-2)25(30-3)18-22(21)23(15-19-11-7-5-8-12-19)27-26(28)16-20-13-9-6-10-14-20/h5-14,17-18,23H,4,15-16H2,1-3H3,(H,27,28)/t23-/m1/s1 |
| InChIKey | YVHSCHVOJVDGFY-HSZRJFAPSA-N |
| XLogP | 4.91 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |