C16H20N4O4 — CID 97038837
6-[4-[(2S)-2-(furan-2-yl)-2-hydroxyethyl]piperazine-1-carbonyl]-2-methylpyridazin-3-one (PubChem CID 97038837) has the molecular formula C16H20N4O4 and a molecular weight of 332.36 g/mol. Its IUPAC name is 6-[4-[(2S)-2-(furan-2-yl)-2-hydroxyethyl]piperazine-1-carbonyl]-2-methylpyridazin-3-one.
| Compound Name | 6-[4-[(2S)-2-(furan-2-yl)-2-hydroxyethyl]piperazine-1-carbonyl]-2-methylpyridazin-3-one |
|---|---|
| PubChem CID | 97038837 |
| Molecular Formula | C16H20N4O4 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 6-[4-[(2S)-2-(furan-2-yl)-2-hydroxyethyl]piperazine-1-carbonyl]-2-methylpyridazin-3-one |
| SMILES | Cn1nc(C(=O)N2CCN(C[C@H](O)c3ccco3)CC2)ccc1=O |
| InChI | InChI=1S/C16H20N4O4/c1-18-15(22)5-4-12(17-18)16(23)20-8-6-19(7-9-20)11-13(21)14-3-2-10-24-14/h2-5,10,13,21H,6-9,11H2,1H3/t13-/m0/s1 |
| InChIKey | XDWWQYLUZXOEIJ-ZDUSSCGKSA-N |
| XLogP | -0.14 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |