About N-[[(4S)-4-hydroxy-2,3-dihydrochromen-4-yl]methyl]-2-methylsulfanylpyridine-3-carboxamide
N-[[(4S)-4-hydroxy-2,3-dihydrochromen-4-yl]methyl]-2-methylsulfanylpyridine-3-carboxamide (PubChem CID 97040498) has the molecular formula C17H18N2O3S
and a molecular weight of 330.41 g/mol. Its IUPAC name is N-[[(4S)-4-hydroxy-2,3-dihydrochromen-4-yl]methyl]-2-methylsulfanylpyridine-3-carboxamide.
Molecular Properties
| Compound Name | N-[[(4S)-4-hydroxy-2,3-dihydrochromen-4-yl]methyl]-2-methylsulfanylpyridine-3-carboxamide |
| PubChem CID | 97040498 |
| Molecular Formula | C17H18N2O3S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | N-[[(4S)-4-hydroxy-2,3-dihydrochromen-4-yl]methyl]-2-methylsulfanylpyridine-3-carboxamide |
| SMILES | CSc1ncccc1C(=O)NC[C@]1(O)CCOc2ccccc21 |
| InChI | InChI=1S/C17H18N2O3S/c1-23-16-12(5-4-9-18-16)15(20)19-11-17(21)8-10-22-14-7-3-2-6-13(14)17/h2-7,9,21H,8,10-11H2,1H3,(H,19,20)/t17-/m1/s1 |
| InChIKey | CJLQMJVUJLYQAH-QGZVFWFLSA-N |
| XLogP | 2.20 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[[(4S)-4-hydroxy-2,3-dihydrochromen-4-yl]methyl]-2-methylsulfanylpyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(4S)-4-hydroxy-2,3-dihydrochromen-4-yl]methyl]-2-methylsulfanylpyridine-3-carboxamide?
The IUPAC name of N-[[(4S)-4-hydroxy-2,3-dihydrochromen-4-yl]methyl]-2-methylsulfanylpyridine-3-carboxamide (CID 97040498) is N-[[(4S)-4-hydroxy-2,3-dihydrochromen-4-yl]methyl]-2-methylsulfanylpyridine-3-carboxamide.
What is the SMILES notation for N-[[(4S)-4-hydroxy-2,3-dihydrochromen-4-yl]methyl]-2-methylsulfanylpyridine-3-carboxamide?
The canonical SMILES for N-[[(4S)-4-hydroxy-2,3-dihydrochromen-4-yl]methyl]-2-methylsulfanylpyridine-3-carboxamide is CSc1ncccc1C(=O)NC[C@]1(O)CCOc2ccccc21.
What is the InChIKey of N-[[(4S)-4-hydroxy-2,3-dihydrochromen-4-yl]methyl]-2-methylsulfanylpyridine-3-carboxamide?
The InChIKey is CJLQMJVUJLYQAH-QGZVFWFLSA-N. The full InChI is InChI=1S/C17H18N2O3S/c1-23-16-12(5-4-9-18-16)15(20)19-11-17(21)8-10-22-14-7-3-2-6-13(14)17/h2-7,9,21H,8,10-11H2,1H3,(H,19,20)/t17-/m1/s1.
What are the key properties of N-[[(4S)-4-hydroxy-2,3-dihydrochromen-4-yl]methyl]-2-methylsulfanylpyridine-3-carboxamide?
N-[[(4S)-4-hydroxy-2,3-dihydrochromen-4-yl]methyl]-2-methylsulfanylpyridine-3-carboxamide has a molecular weight of 330.41 g/mol, XLogP of 2.20, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(4S)-4-hydroxy-2,3-dihydrochromen-4-yl]methyl]-2-methylsulfanylpyridine-3-carboxamide is sourced from PubChem (CID 97040498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).