C16H27N3O3 — CID 97040965
(3R)-N-(1-methylpiperidin-4-yl)-1-(oxan-4-yl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 97040965) has the molecular formula C16H27N3O3 and a molecular weight of 309.41 g/mol. Its IUPAC name is (3R)-N-(1-methylpiperidin-4-yl)-1-(oxan-4-yl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3R)-N-(1-methylpiperidin-4-yl)-1-(oxan-4-yl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 97040965 |
| Molecular Formula | C16H27N3O3 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | (3R)-N-(1-methylpiperidin-4-yl)-1-(oxan-4-yl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | CN1CCC(NC(=O)[C@@H]2CC(=O)N(C3CCOCC3)C2)CC1 |
| InChI | InChI=1S/C16H27N3O3/c1-18-6-2-13(3-7-18)17-16(21)12-10-15(20)19(11-12)14-4-8-22-9-5-14/h12-14H,2-11H2,1H3,(H,17,21)/t12-/m1/s1 |
| InChIKey | NRIBBZNUMCXONC-GFCCVEGCSA-N |
| XLogP | 0.22 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |