C15H20N2O5 — CID 97042863
N-[(3R)-3-(2,5-dimethylfuran-3-yl)-3-hydroxypropyl]-2-(2,5-dioxopyrrolidin-1-yl)acetamide (PubChem CID 97042863) has the molecular formula C15H20N2O5 and a molecular weight of 308.33 g/mol. Its IUPAC name is N-[(3R)-3-(2,5-dimethylfuran-3-yl)-3-hydroxypropyl]-2-(2,5-dioxopyrrolidin-1-yl)acetamide.
| Compound Name | N-[(3R)-3-(2,5-dimethylfuran-3-yl)-3-hydroxypropyl]-2-(2,5-dioxopyrrolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 97042863 |
| Molecular Formula | C15H20N2O5 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | N-[(3R)-3-(2,5-dimethylfuran-3-yl)-3-hydroxypropyl]-2-(2,5-dioxopyrrolidin-1-yl)acetamide |
| SMILES | Cc1cc([C@H](O)CCNC(=O)CN2C(=O)CCC2=O)c(C)o1 |
| InChI | InChI=1S/C15H20N2O5/c1-9-7-11(10(2)22-9)12(18)5-6-16-13(19)8-17-14(20)3-4-15(17)21/h7,12,18H,3-6,8H2,1-2H3,(H,16,19)/t12-/m1/s1 |
| InChIKey | ICCIIDUZLBHYFJ-GFCCVEGCSA-N |
| XLogP | 0.59 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|