About cyclobutyl-[(2R)-2-(3,5-dichlorophenyl)morpholin-4-yl]methanone
cyclobutyl-[(2R)-2-(3,5-dichlorophenyl)morpholin-4-yl]methanone (PubChem CID 97043031) has the molecular formula C15H17Cl2NO2
and a molecular weight of 314.21 g/mol. Its IUPAC name is cyclobutyl-[(2R)-2-(3,5-dichlorophenyl)morpholin-4-yl]methanone.
Molecular Properties
| Compound Name | cyclobutyl-[(2R)-2-(3,5-dichlorophenyl)morpholin-4-yl]methanone |
| PubChem CID | 97043031 |
| Molecular Formula | C15H17Cl2NO2 |
| Molecular Weight | 314.21 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | cyclobutyl-[(2R)-2-(3,5-dichlorophenyl)morpholin-4-yl]methanone |
| SMILES | O=C(C1CCC1)N1CCO[C@H](c2cc(Cl)cc(Cl)c2)C1 |
| InChI | InChI=1S/C15H17Cl2NO2/c16-12-6-11(7-13(17)8-12)14-9-18(4-5-20-14)15(19)10-2-1-3-10/h6-8,10,14H,1-5,9H2/t14-/m0/s1 |
| InChIKey | FYWCVVQGFGMKLW-AWEZNQCLSA-N |
| XLogP | 3.69 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.21 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclobutyl-[(2R)-2-(3,5-dichlorophenyl)morpholin-4-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclobutyl-[(2R)-2-(3,5-dichlorophenyl)morpholin-4-yl]methanone?
The IUPAC name of cyclobutyl-[(2R)-2-(3,5-dichlorophenyl)morpholin-4-yl]methanone (CID 97043031) is cyclobutyl-[(2R)-2-(3,5-dichlorophenyl)morpholin-4-yl]methanone.
What is the SMILES notation for cyclobutyl-[(2R)-2-(3,5-dichlorophenyl)morpholin-4-yl]methanone?
The canonical SMILES for cyclobutyl-[(2R)-2-(3,5-dichlorophenyl)morpholin-4-yl]methanone is O=C(C1CCC1)N1CCO[C@H](c2cc(Cl)cc(Cl)c2)C1.
What is the InChIKey of cyclobutyl-[(2R)-2-(3,5-dichlorophenyl)morpholin-4-yl]methanone?
The InChIKey is FYWCVVQGFGMKLW-AWEZNQCLSA-N. The full InChI is InChI=1S/C15H17Cl2NO2/c16-12-6-11(7-13(17)8-12)14-9-18(4-5-20-14)15(19)10-2-1-3-10/h6-8,10,14H,1-5,9H2/t14-/m0/s1.
What are the key properties of cyclobutyl-[(2R)-2-(3,5-dichlorophenyl)morpholin-4-yl]methanone?
cyclobutyl-[(2R)-2-(3,5-dichlorophenyl)morpholin-4-yl]methanone has a molecular weight of 314.21 g/mol, XLogP of 3.69, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclobutyl-[(2R)-2-(3,5-dichlorophenyl)morpholin-4-yl]methanone is sourced from PubChem (CID 97043031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).