C25H24FN5O3S — CID 97044305
ethyl (3R)-3-[[4-(4-fluorophenyl)-7-thia-2,3,5,10-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),3,5-triene-10-carbonyl]amino]-3-phenylpropanoate (PubChem CID 97044305) has the molecular formula C25H24FN5O3S and a molecular weight of 493.56 g/mol. Its IUPAC name is ethyl (3R)-3-[[4-(4-fluorophenyl)-7-thia-2,3,5,10-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),3,5-triene-10-carbonyl]amino]-3-phenylpropanoate.
| Compound Name | ethyl (3R)-3-[[4-(4-fluorophenyl)-7-thia-2,3,5,10-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),3,5-triene-10-carbonyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 97044305 |
| Molecular Formula | C25H24FN5O3S |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | ethyl (3R)-3-[[4-(4-fluorophenyl)-7-thia-2,3,5,10-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),3,5-triene-10-carbonyl]amino]-3-phenylpropanoate |
| SMILES | CCOC(=O)C[C@@H](NC(=O)N1CCc2c(sc3nc(-c4ccc(F)cc4)nn23)C1)c1ccccc1 |
| InChI | InChI=1S/C25H24FN5O3S/c1-2-34-22(32)14-19(16-6-4-3-5-7-16)27-24(33)30-13-12-20-21(15-30)35-25-28-23(29-31(20)25)17-8-10-18(26)11-9-17/h3-11,19H,2,12-15H2,1H3,(H,27,33)/t19-/m1/s1 |
| InChIKey | ZCHUDJQGOSXSKF-LJQANCHMSA-N |
| XLogP | 4.36 |
| TPSA | 88.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |