C12H21F3N2O3S — CID 97045269
(3R)-1-[[(3S)-1-methylsulfonylpiperidin-3-yl]methyl]-3-(trifluoromethyl)pyrrolidin-3-ol (PubChem CID 97045269) has the molecular formula C12H21F3N2O3S and a molecular weight of 330.37 g/mol. Its IUPAC name is (3R)-1-[[(3S)-1-methylsulfonylpiperidin-3-yl]methyl]-3-(trifluoromethyl)pyrrolidin-3-ol.
| Compound Name | (3R)-1-[[(3S)-1-methylsulfonylpiperidin-3-yl]methyl]-3-(trifluoromethyl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 97045269 |
| Molecular Formula | C12H21F3N2O3S |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | (3R)-1-[[(3S)-1-methylsulfonylpiperidin-3-yl]methyl]-3-(trifluoromethyl)pyrrolidin-3-ol |
| SMILES | CS(=O)(=O)N1CCC[C@@H](CN2CC[C@](O)(C(F)(F)F)C2)C1 |
| InChI | InChI=1S/C12H21F3N2O3S/c1-21(19,20)17-5-2-3-10(8-17)7-16-6-4-11(18,9-16)12(13,14)15/h10,18H,2-9H2,1H3/t10-,11+/m0/s1 |
| InChIKey | NPYGCXWJIXURME-WDEREUQCSA-N |
| XLogP | 0.66 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |