C22H28O5 — CID 97045381
(2S,3S,10R)-5-hydroxy-2,3-dimethyl-6-(3-methylbut-2-enyl)-10-propyl-2,3,9,10-tetrahydropyrano[2,3-h]chromene-4,8-dione (PubChem CID 97045381) has the molecular formula C22H28O5 and a molecular weight of 372.46 g/mol. Its IUPAC name is (2S,3S,10R)-5-hydroxy-2,3-dimethyl-6-(3-methylbut-2-enyl)-10-propyl-2,3,9,10-tetrahydropyrano[2,3-h]chromene-4,8-dione.
| Compound Name | (2S,3S,10R)-5-hydroxy-2,3-dimethyl-6-(3-methylbut-2-enyl)-10-propyl-2,3,9,10-tetrahydropyrano[2,3-h]chromene-4,8-dione |
|---|---|
| PubChem CID | 97045381 |
| Molecular Formula | C22H28O5 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | (2S,3S,10R)-5-hydroxy-2,3-dimethyl-6-(3-methylbut-2-enyl)-10-propyl-2,3,9,10-tetrahydropyrano[2,3-h]chromene-4,8-dione |
| SMILES | CCC[C@@H]1CC(=O)Oc2c(CC=C(C)C)c(O)c3c(c21)O[C@@H](C)[C@H](C)C3=O |
| InChI | InChI=1S/C22H28O5/c1-6-7-14-10-16(23)27-21-15(9-8-11(2)3)20(25)18-19(24)12(4)13(5)26-22(18)17(14)21/h8,12-14,25H,6-7,9-10H2,1-5H3/t12-,13-,14+/m0/s1 |
| InChIKey | NLJGDOQXTXBYON-MELADBBJSA-N |
| XLogP | 4.69 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|