About N-[(4S)-2,2-dimethyloxan-4-yl]-2-(1-pyrrol-1-ylcyclohexyl)acetamide
N-[(4S)-2,2-dimethyloxan-4-yl]-2-(1-pyrrol-1-ylcyclohexyl)acetamide (PubChem CID 97045582) has the molecular formula C19H30N2O2
and a molecular weight of 318.46 g/mol. Its IUPAC name is N-[(4S)-2,2-dimethyloxan-4-yl]-2-(1-pyrrol-1-ylcyclohexyl)acetamide.
Molecular Properties
| Compound Name | N-[(4S)-2,2-dimethyloxan-4-yl]-2-(1-pyrrol-1-ylcyclohexyl)acetamide |
| PubChem CID | 97045582 |
| Molecular Formula | C19H30N2O2 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | N-[(4S)-2,2-dimethyloxan-4-yl]-2-(1-pyrrol-1-ylcyclohexyl)acetamide |
| SMILES | CC1(C)C[C@@H](NC(=O)CC2(n3cccc3)CCCCC2)CCO1 |
| InChI | InChI=1S/C19H30N2O2/c1-18(2)14-16(8-13-23-18)20-17(22)15-19(9-4-3-5-10-19)21-11-6-7-12-21/h6-7,11-12,16H,3-5,8-10,13-15H2,1-2H3,(H,20,22)/t16-/m0/s1 |
| InChIKey | ZCLZODKSRZEXNU-INIZCTEOSA-N |
| XLogP | 3.61 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(4S)-2,2-dimethyloxan-4-yl]-2-(1-pyrrol-1-ylcyclohexyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4S)-2,2-dimethyloxan-4-yl]-2-(1-pyrrol-1-ylcyclohexyl)acetamide?
The IUPAC name of N-[(4S)-2,2-dimethyloxan-4-yl]-2-(1-pyrrol-1-ylcyclohexyl)acetamide (CID 97045582) is N-[(4S)-2,2-dimethyloxan-4-yl]-2-(1-pyrrol-1-ylcyclohexyl)acetamide.
What is the SMILES notation for N-[(4S)-2,2-dimethyloxan-4-yl]-2-(1-pyrrol-1-ylcyclohexyl)acetamide?
The canonical SMILES for N-[(4S)-2,2-dimethyloxan-4-yl]-2-(1-pyrrol-1-ylcyclohexyl)acetamide is CC1(C)C[C@@H](NC(=O)CC2(n3cccc3)CCCCC2)CCO1.
What is the InChIKey of N-[(4S)-2,2-dimethyloxan-4-yl]-2-(1-pyrrol-1-ylcyclohexyl)acetamide?
The InChIKey is ZCLZODKSRZEXNU-INIZCTEOSA-N. The full InChI is InChI=1S/C19H30N2O2/c1-18(2)14-16(8-13-23-18)20-17(22)15-19(9-4-3-5-10-19)21-11-6-7-12-21/h6-7,11-12,16H,3-5,8-10,13-15H2,1-2H3,(H,20,22)/t16-/m0/s1.
What are the key properties of N-[(4S)-2,2-dimethyloxan-4-yl]-2-(1-pyrrol-1-ylcyclohexyl)acetamide?
N-[(4S)-2,2-dimethyloxan-4-yl]-2-(1-pyrrol-1-ylcyclohexyl)acetamide has a molecular weight of 318.46 g/mol, XLogP of 3.61, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4S)-2,2-dimethyloxan-4-yl]-2-(1-pyrrol-1-ylcyclohexyl)acetamide is sourced from PubChem (CID 97045582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).