C26H21N5O3 — CID 97046203
N-[(1R)-2-oxo-1-(4-oxo-3H-phthalazin-1-yl)-2-[(2E)-2-[(Z)-3-phenylprop-2-enylidene]hydrazinyl]ethyl]benzamide (PubChem CID 97046203) has the molecular formula C26H21N5O3 and a molecular weight of 451.49 g/mol. Its IUPAC name is N-[(1R)-2-oxo-1-(4-oxo-3H-phthalazin-1-yl)-2-[(2E)-2-[(Z)-3-phenylprop-2-enylidene]hydrazinyl]ethyl]benzamide.
| Compound Name | N-[(1R)-2-oxo-1-(4-oxo-3H-phthalazin-1-yl)-2-[(2E)-2-[(Z)-3-phenylprop-2-enylidene]hydrazinyl]ethyl]benzamide |
|---|---|
| PubChem CID | 97046203 |
| Molecular Formula | C26H21N5O3 |
| Molecular Weight | 451.49 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | N-[(1R)-2-oxo-1-(4-oxo-3H-phthalazin-1-yl)-2-[(2E)-2-[(Z)-3-phenylprop-2-enylidene]hydrazinyl]ethyl]benzamide |
| SMILES | O=C(N[C@@H](C(=O)N/N=C/C=C\c1ccccc1)c1n[nH]c(=O)c2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C26H21N5O3/c32-24(19-13-5-2-6-14-19)28-23(22-20-15-7-8-16-21(20)25(33)31-29-22)26(34)30-27-17-9-12-18-10-3-1-4-11-18/h1-17,23H,(H,28,32)(H,30,34)(H,31,33)/b12-9-,27-17+/t23-/m1/s1 |
| InChIKey | LOLLBPPCWUFRJZ-XAXGOLKGSA-N |
| XLogP | 3.21 |
| TPSA | 116.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.49 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|