C9H13O4P — CID 97046817
(1'R,4'R)-2-hydroxyspiro[1,3,2λ5-dioxaphosphinane-5,5'-bicyclo[2.2.1]hept-2-ene] 2-oxide (PubChem CID 97046817) has the molecular formula C9H13O4P and a molecular weight of 216.17 g/mol. Its IUPAC name is (1'R,4'R)-2-hydroxyspiro[1,3,2λ5-dioxaphosphinane-5,5'-bicyclo[2.2.1]hept-2-ene] 2-oxide.
| Compound Name | (1'R,4'R)-2-hydroxyspiro[1,3,2λ5-dioxaphosphinane-5,5'-bicyclo[2.2.1]hept-2-ene] 2-oxide |
|---|---|
| PubChem CID | 97046817 |
| Molecular Formula | C9H13O4P |
| Molecular Weight | 216.17 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | (1'R,4'R)-2-hydroxyspiro[1,3,2λ5-dioxaphosphinane-5,5'-bicyclo[2.2.1]hept-2-ene] 2-oxide |
| SMILES | O=P1(O)OCC2(CO1)C[C@@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C9H13O4P/c10-14(11)12-5-9(6-13-14)4-7-1-2-8(9)3-7/h1-2,7-8H,3-6H2,(H,10,11)/t7-,8+/m1/s1 |
| InChIKey | KFMPMTRRWRSWAY-SFYZADRCSA-N |
| XLogP | 1.72 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.17 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|