About thieno[2,3-b]thiophene-2,5-dicarbaldehyde
thieno[2,3-b]thiophene-2,5-dicarbaldehyde (PubChem CID 97046960) has the molecular formula C8H4O2S2
and a molecular weight of 196.25 g/mol. Its IUPAC name is thieno[2,3-b]thiophene-2,5-dicarbaldehyde.
Molecular Properties
| Compound Name | thieno[2,3-b]thiophene-2,5-dicarbaldehyde |
| PubChem CID | 97046960 |
| Molecular Formula | C8H4O2S2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 195.97 |
| IUPAC Name | thieno[2,3-b]thiophene-2,5-dicarbaldehyde |
| SMILES | O=Cc1cc2cc(C=O)sc2s1 |
| InChI | InChI=1S/C8H4O2S2/c9-3-6-1-5-2-7(4-10)12-8(5)11-6/h1-4H |
| InChIKey | BYRWPDKQHOEMTA-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze thieno[2,3-b]thiophene-2,5-dicarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thieno[2,3-b]thiophene-2,5-dicarbaldehyde?
The IUPAC name of thieno[2,3-b]thiophene-2,5-dicarbaldehyde (CID 97046960) is thieno[2,3-b]thiophene-2,5-dicarbaldehyde.
What is the SMILES notation for thieno[2,3-b]thiophene-2,5-dicarbaldehyde?
The canonical SMILES for thieno[2,3-b]thiophene-2,5-dicarbaldehyde is O=Cc1cc2cc(C=O)sc2s1.
What is the InChIKey of thieno[2,3-b]thiophene-2,5-dicarbaldehyde?
The InChIKey is BYRWPDKQHOEMTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4O2S2/c9-3-6-1-5-2-7(4-10)12-8(5)11-6/h1-4H.
What are the key properties of thieno[2,3-b]thiophene-2,5-dicarbaldehyde?
thieno[2,3-b]thiophene-2,5-dicarbaldehyde has a molecular weight of 196.25 g/mol, XLogP of 2.59, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for thieno[2,3-b]thiophene-2,5-dicarbaldehyde is sourced from PubChem (CID 97046960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).