C21H20F2N4O2 — CID 97047699
(3R)-N-(2,5-difluorophenyl)-1-(3-methoxyquinoxalin-2-yl)piperidine-3-carboxamide (PubChem CID 97047699) has the molecular formula C21H20F2N4O2 and a molecular weight of 398.41 g/mol. Its IUPAC name is (3R)-N-(2,5-difluorophenyl)-1-(3-methoxyquinoxalin-2-yl)piperidine-3-carboxamide.
| Compound Name | (3R)-N-(2,5-difluorophenyl)-1-(3-methoxyquinoxalin-2-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 97047699 |
| Molecular Formula | C21H20F2N4O2 |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | (3R)-N-(2,5-difluorophenyl)-1-(3-methoxyquinoxalin-2-yl)piperidine-3-carboxamide |
| SMILES | COc1nc2ccccc2nc1N1CCC[C@@H](C(=O)Nc2cc(F)ccc2F)C1 |
| InChI | InChI=1S/C21H20F2N4O2/c1-29-21-19(24-16-6-2-3-7-17(16)26-21)27-10-4-5-13(12-27)20(28)25-18-11-14(22)8-9-15(18)23/h2-3,6-9,11,13H,4-5,10,12H2,1H3,(H,25,28)/t13-/m1/s1 |
| InChIKey | GTGRXVVHUXFTNK-CYBMUJFWSA-N |
| XLogP | 3.77 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |