C14H18N4O4S — CID 97047892
1-(2-methylsulfonylethyl)-N-[(1S)-1-(2-nitrophenyl)ethyl]pyrazol-3-amine (PubChem CID 97047892) has the molecular formula C14H18N4O4S and a molecular weight of 338.39 g/mol. Its IUPAC name is 1-(2-methylsulfonylethyl)-N-[(1S)-1-(2-nitrophenyl)ethyl]pyrazol-3-amine.
| Compound Name | 1-(2-methylsulfonylethyl)-N-[(1S)-1-(2-nitrophenyl)ethyl]pyrazol-3-amine |
|---|---|
| PubChem CID | 97047892 |
| Molecular Formula | C14H18N4O4S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 1-(2-methylsulfonylethyl)-N-[(1S)-1-(2-nitrophenyl)ethyl]pyrazol-3-amine |
| SMILES | C[C@H](Nc1ccn(CCS(C)(=O)=O)n1)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H18N4O4S/c1-11(12-5-3-4-6-13(12)18(19)20)15-14-7-8-17(16-14)9-10-23(2,21)22/h3-8,11H,9-10H2,1-2H3,(H,15,16)/t11-/m0/s1 |
| InChIKey | QYJXKVCNTGBYGP-NSHDSACASA-N |
| XLogP | 2.01 |
| TPSA | 107.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|