C11H12F6O — CID 97049712
2-[(1S,6S)-1,6-dimethylcyclohexa-2,4-dien-1-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 97049712) has the molecular formula C11H12F6O and a molecular weight of 274.20 g/mol. Its IUPAC name is 2-[(1S,6S)-1,6-dimethylcyclohexa-2,4-dien-1-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[(1S,6S)-1,6-dimethylcyclohexa-2,4-dien-1-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 97049712 |
| Molecular Formula | C11H12F6O |
| Molecular Weight | 274.20 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 2-[(1S,6S)-1,6-dimethylcyclohexa-2,4-dien-1-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | C[C@H]1C=CC=C[C@]1(C)C(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H12F6O/c1-7-5-3-4-6-8(7,2)9(18,10(12,13)14)11(15,16)17/h3-7,18H,1-2H3/t7-,8-/m0/s1 |
| InChIKey | JBYPCQWVZYWFGB-YUMQZZPRSA-N |
| XLogP | 3.61 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.20 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |