About (1S)-1-phenylcyclohexa-2,4-dien-1-amine
(1S)-1-phenylcyclohexa-2,4-dien-1-amine (PubChem CID 97049769) has the molecular formula C12H13N
and a molecular weight of 171.24 g/mol. Its IUPAC name is (1S)-1-phenylcyclohexa-2,4-dien-1-amine.
Molecular Properties
| Compound Name | (1S)-1-phenylcyclohexa-2,4-dien-1-amine |
| PubChem CID | 97049769 |
| Molecular Formula | C12H13N |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | (1S)-1-phenylcyclohexa-2,4-dien-1-amine |
| SMILES | N[C@]1(c2ccccc2)C=CC=CC1 |
| InChI | InChI=1S/C12H13N/c13-12(9-5-2-6-10-12)11-7-3-1-4-8-11/h1-9H,10,13H2/t12-/m1/s1 |
| InChIKey | KJOKQEYSFXGYKR-GFCCVEGCSA-N |
| XLogP | 2.36 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1S)-1-phenylcyclohexa-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-phenylcyclohexa-2,4-dien-1-amine?
The IUPAC name of (1S)-1-phenylcyclohexa-2,4-dien-1-amine (CID 97049769) is (1S)-1-phenylcyclohexa-2,4-dien-1-amine.
What is the SMILES notation for (1S)-1-phenylcyclohexa-2,4-dien-1-amine?
The canonical SMILES for (1S)-1-phenylcyclohexa-2,4-dien-1-amine is N[C@]1(c2ccccc2)C=CC=CC1.
What is the InChIKey of (1S)-1-phenylcyclohexa-2,4-dien-1-amine?
The InChIKey is KJOKQEYSFXGYKR-GFCCVEGCSA-N. The full InChI is InChI=1S/C12H13N/c13-12(9-5-2-6-10-12)11-7-3-1-4-8-11/h1-9H,10,13H2/t12-/m1/s1.
What are the key properties of (1S)-1-phenylcyclohexa-2,4-dien-1-amine?
(1S)-1-phenylcyclohexa-2,4-dien-1-amine has a molecular weight of 171.24 g/mol, XLogP of 2.36, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-phenylcyclohexa-2,4-dien-1-amine is sourced from PubChem (CID 97049769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).