About (3R)-2,3-dimethoxy-5-methyl-4-oxocyclohexa-1,5-diene-1-carbaldehyde
(3R)-2,3-dimethoxy-5-methyl-4-oxocyclohexa-1,5-diene-1-carbaldehyde (PubChem CID 97049784) has the molecular formula C10H12O4
and a molecular weight of 196.20 g/mol. Its IUPAC name is (3R)-2,3-dimethoxy-5-methyl-4-oxocyclohexa-1,5-diene-1-carbaldehyde.
Molecular Properties
| Compound Name | (3R)-2,3-dimethoxy-5-methyl-4-oxocyclohexa-1,5-diene-1-carbaldehyde |
| PubChem CID | 97049784 |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | (3R)-2,3-dimethoxy-5-methyl-4-oxocyclohexa-1,5-diene-1-carbaldehyde |
| SMILES | COC1=C(C=O)C=C(C)C(=O)[C@@H]1OC |
| InChI | InChI=1S/C10H12O4/c1-6-4-7(5-11)9(13-2)10(14-3)8(6)12/h4-5,10H,1-3H3/t10-/m0/s1 |
| InChIKey | JOWTWSVSCCBZEG-JTQLQIEISA-N |
| XLogP | 0.63 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (3R)-2,3-dimethoxy-5-methyl-4-oxocyclohexa-1,5-diene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-2,3-dimethoxy-5-methyl-4-oxocyclohexa-1,5-diene-1-carbaldehyde?
The IUPAC name of (3R)-2,3-dimethoxy-5-methyl-4-oxocyclohexa-1,5-diene-1-carbaldehyde (CID 97049784) is (3R)-2,3-dimethoxy-5-methyl-4-oxocyclohexa-1,5-diene-1-carbaldehyde.
What is the SMILES notation for (3R)-2,3-dimethoxy-5-methyl-4-oxocyclohexa-1,5-diene-1-carbaldehyde?
The canonical SMILES for (3R)-2,3-dimethoxy-5-methyl-4-oxocyclohexa-1,5-diene-1-carbaldehyde is COC1=C(C=O)C=C(C)C(=O)[C@@H]1OC.
What is the InChIKey of (3R)-2,3-dimethoxy-5-methyl-4-oxocyclohexa-1,5-diene-1-carbaldehyde?
The InChIKey is JOWTWSVSCCBZEG-JTQLQIEISA-N. The full InChI is InChI=1S/C10H12O4/c1-6-4-7(5-11)9(13-2)10(14-3)8(6)12/h4-5,10H,1-3H3/t10-/m0/s1.
What are the key properties of (3R)-2,3-dimethoxy-5-methyl-4-oxocyclohexa-1,5-diene-1-carbaldehyde?
(3R)-2,3-dimethoxy-5-methyl-4-oxocyclohexa-1,5-diene-1-carbaldehyde has a molecular weight of 196.20 g/mol, XLogP of 0.63, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-2,3-dimethoxy-5-methyl-4-oxocyclohexa-1,5-diene-1-carbaldehyde is sourced from PubChem (CID 97049784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).