C6H5Cl3O — CID 97049826
(1S,6R)-1,2,6-trichlorocyclohexa-2,4-dien-1-ol (PubChem CID 97049826) has the molecular formula C6H5Cl3O and a molecular weight of 199.46 g/mol. Its IUPAC name is (1S,6R)-1,2,6-trichlorocyclohexa-2,4-dien-1-ol.
| Compound Name | (1S,6R)-1,2,6-trichlorocyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 97049826 |
| Molecular Formula | C6H5Cl3O |
| Molecular Weight | 199.46 g/mol |
| Exact Mass | 197.94 |
| IUPAC Name | (1S,6R)-1,2,6-trichlorocyclohexa-2,4-dien-1-ol |
| SMILES | O[C@@]1(Cl)C(Cl)=CC=C[C@H]1Cl |
| InChI | InChI=1S/C6H5Cl3O/c7-4-2-1-3-5(8)6(4,9)10/h1-4,10H/t4-,6-/m1/s1 |
| InChIKey | LLFLXWLPLGXVGO-INEUFUBQSA-N |
| XLogP | 2.21 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.46 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|