C13H12O4 — CID 97049996
[(1R,8R)-3,6-dihydroxy-1-tricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraenyl] acetate (PubChem CID 97049996) has the molecular formula C13H12O4 and a molecular weight of 232.23 g/mol. Its IUPAC name is [(1R,8R)-3,6-dihydroxy-1-tricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraenyl] acetate.
| Compound Name | [(1R,8R)-3,6-dihydroxy-1-tricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraenyl] acetate |
|---|---|
| PubChem CID | 97049996 |
| Molecular Formula | C13H12O4 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | [(1R,8R)-3,6-dihydroxy-1-tricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraenyl] acetate |
| SMILES | CC(=O)O[C@@]12C=C[C@@H](C1)c1c(O)ccc(O)c12 |
| InChI | InChI=1S/C13H12O4/c1-7(14)17-13-5-4-8(6-13)11-9(15)2-3-10(16)12(11)13/h2-5,8,15-16H,6H2,1H3/t8-,13-/m0/s1 |
| InChIKey | DOLDTEAUSQCVAQ-SDBXPKJASA-N |
| XLogP | 1.91 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|