C13H13NO2 — CID 97050123
(1S)-4-methoxy-1-pyridin-2-ylcyclohexa-2,4-diene-1-carbaldehyde (PubChem CID 97050123) has the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. Its IUPAC name is (1S)-4-methoxy-1-pyridin-2-ylcyclohexa-2,4-diene-1-carbaldehyde.
| Compound Name | (1S)-4-methoxy-1-pyridin-2-ylcyclohexa-2,4-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 97050123 |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | (1S)-4-methoxy-1-pyridin-2-ylcyclohexa-2,4-diene-1-carbaldehyde |
| SMILES | COC1=CC[C@@](C=O)(c2ccccn2)C=C1 |
| InChI | InChI=1S/C13H13NO2/c1-16-11-5-7-13(10-15,8-6-11)12-4-2-3-9-14-12/h2-7,9-10H,8H2,1H3/t13-/m0/s1 |
| InChIKey | KQAHDFBGIPFUQT-ZDUSSCGKSA-N |
| XLogP | 2.01 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|