C17H26FN3O2 — CID 97050710
1-[(1R)-1-(3-fluoro-4-methylphenyl)ethyl]-3-[(2S)-1-morpholin-4-ylpropan-2-yl]urea (PubChem CID 97050710) has the molecular formula C17H26FN3O2 and a molecular weight of 323.41 g/mol. Its IUPAC name is 1-[(1R)-1-(3-fluoro-4-methylphenyl)ethyl]-3-[(2S)-1-morpholin-4-ylpropan-2-yl]urea.
| Compound Name | 1-[(1R)-1-(3-fluoro-4-methylphenyl)ethyl]-3-[(2S)-1-morpholin-4-ylpropan-2-yl]urea |
|---|---|
| PubChem CID | 97050710 |
| Molecular Formula | C17H26FN3O2 |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | 1-[(1R)-1-(3-fluoro-4-methylphenyl)ethyl]-3-[(2S)-1-morpholin-4-ylpropan-2-yl]urea |
| SMILES | Cc1ccc([C@@H](C)NC(=O)N[C@@H](C)CN2CCOCC2)cc1F |
| InChI | InChI=1S/C17H26FN3O2/c1-12-4-5-15(10-16(12)18)14(3)20-17(22)19-13(2)11-21-6-8-23-9-7-21/h4-5,10,13-14H,6-9,11H2,1-3H3,(H2,19,20,22)/t13-,14+/m0/s1 |
| InChIKey | UYZBRKNUXBEXNW-UONOGXRCSA-N |
| XLogP | 2.22 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |