C21H24N4O — CID 97050725
1-[(4-cyanophenyl)methyl]-3-[(1S)-1-(3-pyrrolidin-1-ylphenyl)ethyl]urea (PubChem CID 97050725) has the molecular formula C21H24N4O and a molecular weight of 348.45 g/mol. Its IUPAC name is 1-[(4-cyanophenyl)methyl]-3-[(1S)-1-(3-pyrrolidin-1-ylphenyl)ethyl]urea.
| Compound Name | 1-[(4-cyanophenyl)methyl]-3-[(1S)-1-(3-pyrrolidin-1-ylphenyl)ethyl]urea |
|---|---|
| PubChem CID | 97050725 |
| Molecular Formula | C21H24N4O |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 1-[(4-cyanophenyl)methyl]-3-[(1S)-1-(3-pyrrolidin-1-ylphenyl)ethyl]urea |
| SMILES | C[C@H](NC(=O)NCc1ccc(C#N)cc1)c1cccc(N2CCCC2)c1 |
| InChI | InChI=1S/C21H24N4O/c1-16(19-5-4-6-20(13-19)25-11-2-3-12-25)24-21(26)23-15-18-9-7-17(14-22)8-10-18/h4-10,13,16H,2-3,11-12,15H2,1H3,(H2,23,24,26)/t16-/m0/s1 |
| InChIKey | SEIBNMYXIUCODT-INIZCTEOSA-N |
| XLogP | 3.72 |
| TPSA | 68.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |