C18H29N5O — CID 97050961
1-[(1S,2R)-2-cyclohexylcyclopropyl]-3-[(8S)-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]urea (PubChem CID 97050961) has the molecular formula C18H29N5O and a molecular weight of 331.46 g/mol. Its IUPAC name is 1-[(1S,2R)-2-cyclohexylcyclopropyl]-3-[(8S)-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]urea.
| Compound Name | 1-[(1S,2R)-2-cyclohexylcyclopropyl]-3-[(8S)-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]urea |
|---|---|
| PubChem CID | 97050961 |
| Molecular Formula | C18H29N5O |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.24 |
| IUPAC Name | 1-[(1S,2R)-2-cyclohexylcyclopropyl]-3-[(8S)-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]urea |
| SMILES | CCc1nc2n(n1)CCC[C@@H]2NC(=O)N[C@H]1C[C@@H]1C1CCCCC1 |
| InChI | InChI=1S/C18H29N5O/c1-2-16-21-17-14(9-6-10-23(17)22-16)19-18(24)20-15-11-13(15)12-7-4-3-5-8-12/h12-15H,2-11H2,1H3,(H2,19,20,24)/t13-,14+,15+/m1/s1 |
| InChIKey | GYESPOYMRVPPEE-ILXRZTDVSA-N |
| XLogP | 2.94 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |