C18H32N4O3 — CID 97050994
3-[(2S)-4-methylpentan-2-yl]oxy-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]propanamide (PubChem CID 97050994) has the molecular formula C18H32N4O3 and a molecular weight of 352.48 g/mol. Its IUPAC name is 3-[(2S)-4-methylpentan-2-yl]oxy-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]propanamide.
| Compound Name | 3-[(2S)-4-methylpentan-2-yl]oxy-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]propanamide |
|---|---|
| PubChem CID | 97050994 |
| Molecular Formula | C18H32N4O3 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.25 |
| IUPAC Name | 3-[(2S)-4-methylpentan-2-yl]oxy-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]propanamide |
| SMILES | CC(C)C[C@H](C)OCCC(=O)NCCCn1nc2n(c1=O)CCCC2 |
| InChI | InChI=1S/C18H32N4O3/c1-14(2)13-15(3)25-12-8-17(23)19-9-6-11-22-18(24)21-10-5-4-7-16(21)20-22/h14-15H,4-13H2,1-3H3,(H,19,23)/t15-/m0/s1 |
| InChIKey | WRJQTTCPKVBDDG-HNNXBMFYSA-N |
| XLogP | 1.73 |
| TPSA | 78.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|